About sodium N-oxidopropan-2-imine
sodium N-oxidopropan-2-imine (PubChem CID 23680170) has the molecular formula C3H6NNaO
and a molecular weight of 95.08 g/mol. Its IUPAC name is sodium N-oxidopropan-2-imine.
Molecular Properties
| Compound Name | sodium N-oxidopropan-2-imine |
| PubChem CID | 23680170 |
| Molecular Formula | C3H6NNaO |
| Molecular Weight | 95.08 g/mol |
| Exact Mass | 95.03 |
| IUPAC Name | sodium N-oxidopropan-2-imine |
| SMILES | CC(C)=N[O-].[Na+] |
| InChI | InChI=1S/C3H7NO.Na/c1-3(2)4-5;/h5H,1-2H3;/q;+1/p-1 |
| InChIKey | CSVSCECTZOBDCR-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.08 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium N-oxidopropan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-oxidopropan-2-imine?
The IUPAC name of sodium N-oxidopropan-2-imine (CID 23680170) is sodium N-oxidopropan-2-imine.
What is the SMILES notation for sodium N-oxidopropan-2-imine?
The canonical SMILES for sodium N-oxidopropan-2-imine is CC(C)=N[O-].[Na+].
What is the InChIKey of sodium N-oxidopropan-2-imine?
The InChIKey is CSVSCECTZOBDCR-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H7NO.Na/c1-3(2)4-5;/h5H,1-2H3;/q;+1/p-1.
What are the key properties of sodium N-oxidopropan-2-imine?
sodium N-oxidopropan-2-imine has a molecular weight of 95.08 g/mol, XLogP of -2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-oxidopropan-2-imine is sourced from PubChem (CID 23680170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).