About sodium N-hydroxyethanimidate
sodium N-hydroxyethanimidate (PubChem CID 102059901) has the molecular formula C2H4NNaO2
and a molecular weight of 97.05 g/mol. Its IUPAC name is sodium N-hydroxyethanimidate.
Molecular Properties
| Compound Name | sodium N-hydroxyethanimidate |
| PubChem CID | 102059901 |
| Molecular Formula | C2H4NNaO2 |
| Molecular Weight | 97.05 g/mol |
| Exact Mass | 97.01 |
| IUPAC Name | sodium N-hydroxyethanimidate |
| SMILES | CC([O-])=NO.[Na+] |
| InChI | InChI=1S/C2H5NO2.Na/c1-2(4)3-5;/h5H,1H3,(H,3,4);/q;+1/p-1 |
| InChIKey | NAPLXXAGJQRTAQ-UHFFFAOYSA-M |
| XLogP | -3.84 |
| TPSA | 55.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.05 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium N-hydroxyethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-hydroxyethanimidate?
The IUPAC name of sodium N-hydroxyethanimidate (CID 102059901) is sodium N-hydroxyethanimidate.
What is the SMILES notation for sodium N-hydroxyethanimidate?
The canonical SMILES for sodium N-hydroxyethanimidate is CC([O-])=NO.[Na+].
What is the InChIKey of sodium N-hydroxyethanimidate?
The InChIKey is NAPLXXAGJQRTAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NO2.Na/c1-2(4)3-5;/h5H,1H3,(H,3,4);/q;+1/p-1.
What are the key properties of sodium N-hydroxyethanimidate?
sodium N-hydroxyethanimidate has a molecular weight of 97.05 g/mol, XLogP of -3.84, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-hydroxyethanimidate is sourced from PubChem (CID 102059901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).