About ethynylboronic acid
ethynylboronic acid (PubChem CID 22173396) has the molecular formula C2H3BO2
and a molecular weight of 69.86 g/mol. Its IUPAC name is ethynylboronic acid.
Molecular Properties
| Compound Name | ethynylboronic acid |
| PubChem CID | 22173396 |
| Molecular Formula | C2H3BO2 |
| Molecular Weight | 69.86 g/mol |
| Exact Mass | 70.02 |
| IUPAC Name | ethynylboronic acid |
| SMILES | C#CB(O)O |
| InChI | InChI=1S/C2H3BO2/c1-2-3(4)5/h1,4-5H |
| InChIKey | QKBHVMBPNSNIHV-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 69.86 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethynylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethynylboronic acid?
The IUPAC name of ethynylboronic acid (CID 22173396) is ethynylboronic acid.
What is the SMILES notation for ethynylboronic acid?
The canonical SMILES for ethynylboronic acid is C#CB(O)O.
What is the InChIKey of ethynylboronic acid?
The InChIKey is QKBHVMBPNSNIHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3BO2/c1-2-3(4)5/h1,4-5H.
What are the key properties of ethynylboronic acid?
ethynylboronic acid has a molecular weight of 69.86 g/mol, XLogP of -1.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethynylboronic acid is sourced from PubChem (CID 22173396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).