C24H42 — CID 173077250
3,3,9-trimethyl-6-(2-methylbut-3-enyl)-5-pentan-2-ylundeca-1,5,10-triene (PubChem CID 173077250) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is 3,3,9-trimethyl-6-(2-methylbut-3-enyl)-5-pentan-2-ylundeca-1,5,10-triene.
| Compound Name | 3,3,9-trimethyl-6-(2-methylbut-3-enyl)-5-pentan-2-ylundeca-1,5,10-triene |
|---|---|
| PubChem CID | 173077250 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 3,3,9-trimethyl-6-(2-methylbut-3-enyl)-5-pentan-2-ylundeca-1,5,10-triene |
| SMILES | C=CC(C)CCC(CC(C)C=C)=C(CC(C)(C)C=C)C(C)CCC |
| InChI | InChI=1S/C24H42/c1-10-14-21(7)23(18-24(8,9)13-4)22(17-20(6)12-3)16-15-19(5)11-2/h11-13,19-21H,2-4,10,14-18H2,1,5-9H3 |
| InChIKey | HYZRJTWODCYYME-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|