C20H40O2 — CID 174922668
2,6-dimethyloct-7-en-2-ol;3,7-dimethyloct-1-en-3-ol (PubChem CID 174922668) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 2,6-dimethyloct-7-en-2-ol;3,7-dimethyloct-1-en-3-ol.
| Compound Name | 2,6-dimethyloct-7-en-2-ol;3,7-dimethyloct-1-en-3-ol |
|---|---|
| PubChem CID | 174922668 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 2,6-dimethyloct-7-en-2-ol;3,7-dimethyloct-1-en-3-ol |
| SMILES | C=CC(C)(O)CCCC(C)C.C=CC(C)CCCC(C)(C)O |
| InChI | InChI=1S/2C10H20O/c1-5-9(2)7-6-8-10(3,4)11;1-5-10(4,11)8-6-7-9(2)3/h2*5,9,11H,1,6-8H2,2-4H3 |
| InChIKey | HXYVPDNIDXXKCK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|