C11H22O2 — CID 134957540
(3S,6S)-2,3,6-trimethyloct-7-ene-2,6-diol (PubChem CID 134957540) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (3S,6S)-2,3,6-trimethyloct-7-ene-2,6-diol.
| Compound Name | (3S,6S)-2,3,6-trimethyloct-7-ene-2,6-diol |
|---|---|
| PubChem CID | 134957540 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (3S,6S)-2,3,6-trimethyloct-7-ene-2,6-diol |
| SMILES | C=C[C@@](C)(O)CC[C@H](C)C(C)(C)O |
| InChI | InChI=1S/C11H22O2/c1-6-11(5,13)8-7-9(2)10(3,4)12/h6,9,12-13H,1,7-8H2,2-5H3/t9-,11+/m0/s1 |
| InChIKey | WQPFFVSJBPGPRC-GXSJLCMTSA-N |
| XLogP | 2.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|