C27H42N2O4S — CID 123653200
[3-hydroxy-7,10a-dimethyl-7-(4-methylpentyl)-5,5-dioxo-6a,8,9,10-tetrahydro-6H-benzo[c]thiochromen-1-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 123653200) has the molecular formula C27H42N2O4S and a molecular weight of 490.71 g/mol. Its IUPAC name is [3-hydroxy-7,10a-dimethyl-7-(4-methylpentyl)-5,5-dioxo-6a,8,9,10-tetrahydro-6H-benzo[c]thiochromen-1-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [3-hydroxy-7,10a-dimethyl-7-(4-methylpentyl)-5,5-dioxo-6a,8,9,10-tetrahydro-6H-benzo[c]thiochromen-1-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 123653200 |
| Molecular Formula | C27H42N2O4S |
| Molecular Weight | 490.71 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | [3-hydroxy-7,10a-dimethyl-7-(4-methylpentyl)-5,5-dioxo-6a,8,9,10-tetrahydro-6H-benzo[c]thiochromen-1-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CC(C)CCCC1(C)CCCC2(C)c3c(C(=O)N4CCN(C)CC4)cc(O)cc3S(=O)(=O)CC12 |
| InChI | InChI=1S/C27H42N2O4S/c1-19(2)8-6-9-26(3)10-7-11-27(4)23(26)18-34(32,33)22-17-20(30)16-21(24(22)27)25(31)29-14-12-28(5)13-15-29/h16-17,19,23,30H,6-15,18H2,1-5H3 |
| InChIKey | NGDWYMZURBTXPO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |