C15H28F2O2 — CID 123653440
4,4-difluoro-5-methyl-1-[2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxyhex-2-ene (PubChem CID 123653440) has the molecular formula C15H28F2O2 and a molecular weight of 278.38 g/mol. Its IUPAC name is 4,4-difluoro-5-methyl-1-[2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxyhex-2-ene.
| Compound Name | 4,4-difluoro-5-methyl-1-[2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxyhex-2-ene |
|---|---|
| PubChem CID | 123653440 |
| Molecular Formula | C15H28F2O2 |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 4,4-difluoro-5-methyl-1-[2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxyhex-2-ene |
| SMILES | CC(C)C(F)(F)C=CCOC(C)(C)COC(C)(C)C |
| InChI | InChI=1S/C15H28F2O2/c1-12(2)15(16,17)9-8-10-18-14(6,7)11-19-13(3,4)5/h8-9,12H,10-11H2,1-7H3 |
| InChIKey | UYWDWETWIRNUQR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|