C9H8N4O2 — CID 123654209
methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate (PubChem CID 123654209) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate.
| Compound Name | methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 123654209 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate |
| SMILES | COC(=O)c1ccc2ncnc(N)c2n1 |
| InChI | InChI=1S/C9H8N4O2/c1-15-9(14)6-3-2-5-7(13-6)8(10)12-4-11-5/h2-4H,1H3,(H2,10,11,12) |
| InChIKey | IRNAKRIIKQEPGU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |