methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate

C9H8N4O2 — CID 123654209

IUPACmethyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate
SMILESCOC(=O)c1ccc2ncnc(N)c2n1
InChIInChI=1S/C9H8N4O2/c1-15-9(14)6-3-2-5-7(13-6)8(10)12-4-11-5/h2-4H,1H3,(H2,10,11,12)
InChIKeyIRNAKRIIKQEPGU-UHFFFAOYSA-N
MW204.19 g/mol
LogP0.39
Rot. Bonds1

About methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate

methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate (PubChem CID 123654209) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate.

Molecular Properties

Compound Namemethyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate
PubChem CID123654209
Molecular FormulaC9H8N4O2
Molecular Weight204.19 g/mol
Exact Mass204.06
IUPAC Namemethyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate
SMILESCOC(=O)c1ccc2ncnc(N)c2n1
InChIInChI=1S/C9H8N4O2/c1-15-9(14)6-3-2-5-7(13-6)8(10)12-4-11-5/h2-4H,1H3,(H2,10,11,12)
InChIKeyIRNAKRIIKQEPGU-UHFFFAOYSA-N
XLogP0.39
TPSA90.99 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.19
LogP ≤ 50.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate?
The IUPAC name of methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate (CID 123654209) is methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate.
What is the SMILES notation for methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate?
The canonical SMILES for methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate is COC(=O)c1ccc2ncnc(N)c2n1.
What is the InChIKey of methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate?
The InChIKey is IRNAKRIIKQEPGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O2/c1-15-9(14)6-3-2-5-7(13-6)8(10)12-4-11-5/h2-4H,1H3,(H2,10,11,12).
What are the key properties of methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate?
methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate has a molecular weight of 204.19 g/mol, XLogP of 0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-aminopyrido[3,2-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 123654209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).