6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid

C10H17NO2 — CID 123654223

IUPAC6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid
SMILESCNCC(=CC=CC(C)C)C(=O)O
InChIInChI=1S/C10H17NO2/c1-8(2)5-4-6-9(7-11-3)10(12)13/h4-6,8,11H,7H2,1-3H3,(H,12,13)
InChIKeyJUAUNYUXPSRHRW-UHFFFAOYSA-N
MW183.25 g/mol
LogP1.43
Rot. Bonds5

About 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid

6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid (PubChem CID 123654223) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid.

Molecular Properties

Compound Name6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid
PubChem CID123654223
Molecular FormulaC10H17NO2
Molecular Weight183.25 g/mol
Exact Mass183.13
IUPAC Name6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid
SMILESCNCC(=CC=CC(C)C)C(=O)O
InChIInChI=1S/C10H17NO2/c1-8(2)5-4-6-9(7-11-3)10(12)13/h4-6,8,11H,7H2,1-3H3,(H,12,13)
InChIKeyJUAUNYUXPSRHRW-UHFFFAOYSA-N
XLogP1.43
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.25
LogP ≤ 51.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid?
The IUPAC name of 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid (CID 123654223) is 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid.
What is the SMILES notation for 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid?
The canonical SMILES for 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid is CNCC(=CC=CC(C)C)C(=O)O.
What is the InChIKey of 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid?
The InChIKey is JUAUNYUXPSRHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-8(2)5-4-6-9(7-11-3)10(12)13/h4-6,8,11H,7H2,1-3H3,(H,12,13).
What are the key properties of 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid?
6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid has a molecular weight of 183.25 g/mol, XLogP of 1.43, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-(methylaminomethyl)hepta-2,4-dienoic acid is sourced from PubChem (CID 123654223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).