C22H25N5O4S — CID 123655041
N-(3-amino-2,2-dimethyl-1,1-dioxospiro[1,4-thiazinane-5,4'-2,3-dihydrochromene]-6'-yl)pyrazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 123655041) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethyl-1,1-dioxospiro[1,4-thiazinane-5,4'-2,3-dihydrochromene]-6'-yl)pyrazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | N-(3-amino-2,2-dimethyl-1,1-dioxospiro[1,4-thiazinane-5,4'-2,3-dihydrochromene]-6'-yl)pyrazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123655041 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-(3-amino-2,2-dimethyl-1,1-dioxospiro[1,4-thiazinane-5,4'-2,3-dihydrochromene]-6'-yl)pyrazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | CC1(C)C(N)NC2(CCOc3ccc(NC(=O)c4cc5ccccn5n4)cc32)CS1(=O)=O |
| InChI | InChI=1S/C22H25N5O4S/c1-21(2)20(23)25-22(13-32(21,29)30)8-10-31-18-7-6-14(11-16(18)22)24-19(28)17-12-15-5-3-4-9-27(15)26-17/h3-7,9,11-12,20,25H,8,10,13,23H2,1-2H3,(H,24,28) |
| InChIKey | NLIKVKRKJDHHJI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |