C30H55NO6 — CID 123656649
(5-ethyl-3-methylnonan-3-yl) 7-methyl-7-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]decanoate (PubChem CID 123656649) has the molecular formula C30H55NO6 and a molecular weight of 525.77 g/mol. Its IUPAC name is (5-ethyl-3-methylnonan-3-yl) 7-methyl-7-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]decanoate.
| Compound Name | (5-ethyl-3-methylnonan-3-yl) 7-methyl-7-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]decanoate |
|---|---|
| PubChem CID | 123656649 |
| Molecular Formula | C30H55NO6 |
| Molecular Weight | 525.77 g/mol |
| Exact Mass | 525.40 |
| IUPAC Name | (5-ethyl-3-methylnonan-3-yl) 7-methyl-7-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]decanoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OC(C)(CCC)CCCCCC(=O)OC(C)(CC)CC(CC)CCCC |
| InChI | InChI=1S/C30H55NO6/c1-9-13-17-25(11-3)23-29(7,12-4)36-26(32)18-15-14-16-20-30(8,19-10-2)37-28(34)31-21-22-35-27(33)24(5)6/h25H,5,9-23H2,1-4,6-8H3,(H,31,34) |
| InChIKey | WGOZESCLVHBUSP-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.77 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|