C38H69NO8 — CID 138721212
2-[[2-[8-[6-(2-ethylhexoxy)-6-methyl-5-oxoheptoxy]-7,7,8-trimethyl-6-oxononoxy]-2-methylpropanoyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 138721212) has the molecular formula C38H69NO8 and a molecular weight of 667.97 g/mol. Its IUPAC name is 2-[[2-[8-[6-(2-ethylhexoxy)-6-methyl-5-oxoheptoxy]-7,7,8-trimethyl-6-oxononoxy]-2-methylpropanoyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2-[8-[6-(2-ethylhexoxy)-6-methyl-5-oxoheptoxy]-7,7,8-trimethyl-6-oxononoxy]-2-methylpropanoyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138721212 |
| Molecular Formula | C38H69NO8 |
| Molecular Weight | 667.97 g/mol |
| Exact Mass | 667.50 |
| IUPAC Name | 2-[[2-[8-[6-(2-ethylhexoxy)-6-methyl-5-oxoheptoxy]-7,7,8-trimethyl-6-oxononoxy]-2-methylpropanoyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)C(C)(C)OCCCCCC(=O)C(C)(C)C(C)(C)OCCCCC(=O)C(C)(C)OCC(CC)CCCC |
| InChI | InChI=1S/C38H69NO8/c1-13-15-21-30(14-2)28-47-36(7,8)32(41)23-18-20-26-46-38(11,12)35(5,6)31(40)22-17-16-19-25-45-37(9,10)34(43)39-24-27-44-33(42)29(3)4/h30H,3,13-28H2,1-2,4-12H3,(H,39,43) |
| InChIKey | JDWLOMMGIZEYHO-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.97 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|