C28H51NO6 — CID 144583150
2-[[2-[7-(2-ethylheptoxy)-7-methyl-6-oxooctoxy]-2-methylbutanoyl]amino]ethyl prop-2-enoate (PubChem CID 144583150) has the molecular formula C28H51NO6 and a molecular weight of 497.72 g/mol. Its IUPAC name is 2-[[2-[7-(2-ethylheptoxy)-7-methyl-6-oxooctoxy]-2-methylbutanoyl]amino]ethyl prop-2-enoate.
| Compound Name | 2-[[2-[7-(2-ethylheptoxy)-7-methyl-6-oxooctoxy]-2-methylbutanoyl]amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 144583150 |
| Molecular Formula | C28H51NO6 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.37 |
| IUPAC Name | 2-[[2-[7-(2-ethylheptoxy)-7-methyl-6-oxooctoxy]-2-methylbutanoyl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)C(C)(CC)OCCCCCC(=O)C(C)(C)OCC(CC)CCCCC |
| InChI | InChI=1S/C28H51NO6/c1-8-12-14-17-23(9-2)22-35-27(5,6)24(30)18-15-13-16-20-34-28(7,11-4)26(32)29-19-21-33-25(31)10-3/h10,23H,3,8-9,11-22H2,1-2,4-7H3,(H,29,32) |
| InChIKey | BBBGXDHAWALZKE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|