C30H28N8O4 — CID 123657151
[[amino-[5-[8-morpholin-4-yl-2-(2-quinolin-2-ylethenyl)imidazo[1,2-a]pyrazin-5-yl]-2-pyridinyl]methylidene]amino] ethyl carbonate (PubChem CID 123657151) has the molecular formula C30H28N8O4 and a molecular weight of 564.61 g/mol. Its IUPAC name is [[amino-[5-[8-morpholin-4-yl-2-(2-quinolin-2-ylethenyl)imidazo[1,2-a]pyrazin-5-yl]-2-pyridinyl]methylidene]amino] ethyl carbonate.
| Compound Name | [[amino-[5-[8-morpholin-4-yl-2-(2-quinolin-2-ylethenyl)imidazo[1,2-a]pyrazin-5-yl]-2-pyridinyl]methylidene]amino] ethyl carbonate |
|---|---|
| PubChem CID | 123657151 |
| Molecular Formula | C30H28N8O4 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | [[amino-[5-[8-morpholin-4-yl-2-(2-quinolin-2-ylethenyl)imidazo[1,2-a]pyrazin-5-yl]-2-pyridinyl]methylidene]amino] ethyl carbonate |
| SMILES | CCOC(=O)ON=C(N)c1ccc(-c2cnc(N3CCOCC3)c3nc(C=Cc4ccc5ccccc5n4)cn23)cn1 |
| InChI | InChI=1S/C30H28N8O4/c1-2-41-30(39)42-36-27(31)25-12-8-21(17-32-25)26-18-33-28(37-13-15-40-16-14-37)29-35-23(19-38(26)29)11-10-22-9-7-20-5-3-4-6-24(20)34-22/h3-12,17-19H,2,13-16H2,1H3,(H2,31,36) |
| InChIKey | KJVYYBNWJWLFOT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 142.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|