C21H21N7O3 — CID 136942070
N'-hydroxy-8-morpholin-4-yl-2-(quinolin-2-yloxymethyl)imidazo[1,2-a]pyrazine-5-carboximidamide (PubChem CID 136942070) has the molecular formula C21H21N7O3 and a molecular weight of 419.45 g/mol. Its IUPAC name is N'-hydroxy-8-morpholin-4-yl-2-(quinolin-2-yloxymethyl)imidazo[1,2-a]pyrazine-5-carboximidamide.
| Compound Name | N'-hydroxy-8-morpholin-4-yl-2-(quinolin-2-yloxymethyl)imidazo[1,2-a]pyrazine-5-carboximidamide |
|---|---|
| PubChem CID | 136942070 |
| Molecular Formula | C21H21N7O3 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N'-hydroxy-8-morpholin-4-yl-2-(quinolin-2-yloxymethyl)imidazo[1,2-a]pyrazine-5-carboximidamide |
| SMILES | N/C(=N\O)c1cnc(N2CCOCC2)c2nc(COc3ccc4ccccc4n3)cn12 |
| InChI | InChI=1S/C21H21N7O3/c22-19(26-29)17-11-23-20(27-7-9-30-10-8-27)21-24-15(12-28(17)21)13-31-18-6-5-14-3-1-2-4-16(14)25-18/h1-6,11-12,29H,7-10,13H2,(H2,22,26) |
| InChIKey | GFOISQPFBVESFP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|