C25H24F5N3O3 — CID 123657518
3-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-7,8,8-trimethyl-5,6,7,9-tetrahydropyrimido[1,6-a]azepin-1-one (PubChem CID 123657518) has the molecular formula C25H24F5N3O3 and a molecular weight of 509.48 g/mol. Its IUPAC name is 3-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-7,8,8-trimethyl-5,6,7,9-tetrahydropyrimido[1,6-a]azepin-1-one.
| Compound Name | 3-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-7,8,8-trimethyl-5,6,7,9-tetrahydropyrimido[1,6-a]azepin-1-one |
|---|---|
| PubChem CID | 123657518 |
| Molecular Formula | C25H24F5N3O3 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 3-[[3,5-difluoro-4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]methoxy]-7,8,8-trimethyl-5,6,7,9-tetrahydropyrimido[1,6-a]azepin-1-one |
| SMILES | CC1CCc2cc(OCc3cc(F)c(Oc4ccnc(C(F)(F)F)c4)c(F)c3)nc(=O)n2CC1(C)C |
| InChI | InChI=1S/C25H24F5N3O3/c1-14-4-5-16-10-21(32-23(34)33(16)13-24(14,2)3)35-12-15-8-18(26)22(19(27)9-15)36-17-6-7-31-20(11-17)25(28,29)30/h6-11,14H,4-5,12-13H2,1-3H3 |
| InChIKey | KNNSTHHJFASILN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |