About 4-ethenyl-1,4-dimethylazepin-1-ium
4-ethenyl-1,4-dimethylazepin-1-ium (PubChem CID 123657680) has the molecular formula C10H14N+
and a molecular weight of 148.23 g/mol. Its IUPAC name is 4-ethenyl-1,4-dimethylazepin-1-ium.
Molecular Properties
| Compound Name | 4-ethenyl-1,4-dimethylazepin-1-ium |
| PubChem CID | 123657680 |
| Molecular Formula | C10H14N+ |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 4-ethenyl-1,4-dimethylazepin-1-ium |
| SMILES | C=CC1(C)C=CC=[N+](C)C=C1 |
| InChI | InChI=1S/C10H14N/c1-4-10(2)6-5-8-11(3)9-7-10/h4-9H,1H2,2-3H3/q+1 |
| InChIKey | MFZUWMIDBRBCNB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-1,4-dimethylazepin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-1,4-dimethylazepin-1-ium?
The IUPAC name of 4-ethenyl-1,4-dimethylazepin-1-ium (CID 123657680) is 4-ethenyl-1,4-dimethylazepin-1-ium.
What is the SMILES notation for 4-ethenyl-1,4-dimethylazepin-1-ium?
The canonical SMILES for 4-ethenyl-1,4-dimethylazepin-1-ium is C=CC1(C)C=CC=[N+](C)C=C1.
What is the InChIKey of 4-ethenyl-1,4-dimethylazepin-1-ium?
The InChIKey is MFZUWMIDBRBCNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N/c1-4-10(2)6-5-8-11(3)9-7-10/h4-9H,1H2,2-3H3/q+1.
What are the key properties of 4-ethenyl-1,4-dimethylazepin-1-ium?
4-ethenyl-1,4-dimethylazepin-1-ium has a molecular weight of 148.23 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-1,4-dimethylazepin-1-ium is sourced from PubChem (CID 123657680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).