About 2-fluoro-4,4-dimethylazepine
2-fluoro-4,4-dimethylazepine (PubChem CID 177210027) has the molecular formula C8H10FN
and a molecular weight of 139.17 g/mol. Its IUPAC name is 2-fluoro-4,4-dimethylazepine.
Molecular Properties
| Compound Name | 2-fluoro-4,4-dimethylazepine |
| PubChem CID | 177210027 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 2-fluoro-4,4-dimethylazepine |
| SMILES | CC1(C)C=CC=NC(F)=C1 |
| InChI | InChI=1S/C8H10FN/c1-8(2)4-3-5-10-7(9)6-8/h3-6H,1-2H3 |
| InChIKey | AQUHAMXMQZDSPA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4,4-dimethylazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4,4-dimethylazepine?
The IUPAC name of 2-fluoro-4,4-dimethylazepine (CID 177210027) is 2-fluoro-4,4-dimethylazepine.
What is the SMILES notation for 2-fluoro-4,4-dimethylazepine?
The canonical SMILES for 2-fluoro-4,4-dimethylazepine is CC1(C)C=CC=NC(F)=C1.
What is the InChIKey of 2-fluoro-4,4-dimethylazepine?
The InChIKey is AQUHAMXMQZDSPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN/c1-8(2)4-3-5-10-7(9)6-8/h3-6H,1-2H3.
What are the key properties of 2-fluoro-4,4-dimethylazepine?
2-fluoro-4,4-dimethylazepine has a molecular weight of 139.17 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4,4-dimethylazepine is sourced from PubChem (CID 177210027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).