C8H12FN — CID 171558229
(Z,E)-N-[(E)-1-fluoroprop-1-enyl]pent-2-en-1-imine (PubChem CID 171558229) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is (Z,E)-N-[(E)-1-fluoroprop-1-enyl]pent-2-en-1-imine.
| Compound Name | (Z,E)-N-[(E)-1-fluoroprop-1-enyl]pent-2-en-1-imine |
|---|---|
| PubChem CID | 171558229 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | (Z,E)-N-[(E)-1-fluoroprop-1-enyl]pent-2-en-1-imine |
| SMILES | C/C=C(F)\N=C/C=C/CC |
| InChI | InChI=1S/C8H12FN/c1-3-5-6-7-10-8(9)4-2/h4-7H,3H2,1-2H3/b6-5+,8-4-,10-7- |
| InChIKey | WVXNLZTXJODOST-MVIGZDABSA-N |
| XLogP | 2.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|