C9H14F3N — CID 143532055
N-ethenylethanimine;(Z)-5,5,5-trifluoropent-2-ene (PubChem CID 143532055) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is N-ethenylethanimine;(Z)-5,5,5-trifluoropent-2-ene.
| Compound Name | N-ethenylethanimine;(Z)-5,5,5-trifluoropent-2-ene |
|---|---|
| PubChem CID | 143532055 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-ethenylethanimine;(Z)-5,5,5-trifluoropent-2-ene |
| SMILES | C/C=C\CC(F)(F)F.C=C/N=C/C |
| InChI | InChI=1S/C5H7F3.C4H7N/c1-2-3-4-5(6,7)8;1-3-5-4-2/h2-3H,4H2,1H3;3-4H,1H2,2H3/b3-2-;5-4+ |
| InChIKey | AWBJXURLZWSGGL-XUFSOBNHSA-N |
| XLogP | 3.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|