C8H10FN — CID 143657985
5-fluoro-3,3-dimethylazepine (PubChem CID 143657985) has the molecular formula C8H10FN and a molecular weight of 139.17 g/mol. Its IUPAC name is 5-fluoro-3,3-dimethylazepine.
| Compound Name | 5-fluoro-3,3-dimethylazepine |
|---|---|
| PubChem CID | 143657985 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 5-fluoro-3,3-dimethylazepine |
| SMILES | CC1(C)C=NC=CC(F)=C1 |
| InChI | InChI=1S/C8H10FN/c1-8(2)5-7(9)3-4-10-6-8/h3-6H,1-2H3 |
| InChIKey | KOAVUGPMSIKGJF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |