C12H15ClF3NO — CID 123658305
N-[4-chloro-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-2,2-dimethylpropanamide (PubChem CID 123658305) has the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 123658305 |
| Molecular Formula | C12H15ClF3NO |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC1=CC(C(F)(F)F)C(Cl)C=C1 |
| InChI | InChI=1S/C12H15ClF3NO/c1-11(2,3)10(18)17-7-4-5-9(13)8(6-7)12(14,15)16/h4-6,8-9H,1-3H3,(H,17,18) |
| InChIKey | ILAYIQDWNRNXNL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|