C43H53N7O2 — CID 123658311
2-[2-[[3-[2-(1,4-diazepan-1-yl)ethyl-methylcarbamoyl]phenyl]methylamino]-5-piperidin-1-ylphenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide (PubChem CID 123658311) has the molecular formula C43H53N7O2 and a molecular weight of 699.94 g/mol. Its IUPAC name is 2-[2-[[3-[2-(1,4-diazepan-1-yl)ethyl-methylcarbamoyl]phenyl]methylamino]-5-piperidin-1-ylphenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide.
| Compound Name | 2-[2-[[3-[2-(1,4-diazepan-1-yl)ethyl-methylcarbamoyl]phenyl]methylamino]-5-piperidin-1-ylphenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 123658311 |
| Molecular Formula | C43H53N7O2 |
| Molecular Weight | 699.94 g/mol |
| Exact Mass | 699.43 |
| IUPAC Name | 2-[2-[[3-[2-(1,4-diazepan-1-yl)ethyl-methylcarbamoyl]phenyl]methylamino]-5-piperidin-1-ylphenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-4-carboxamide |
| SMILES | CN(CCN1CCCNCC1)C(=O)c1cccc(CNc2ccc(N3CCCCC3)cc2-c2cc(C(=O)NC3CCCc4ccccc43)ccn2)c1 |
| InChI | InChI=1S/C43H53N7O2/c1-48(26-27-49-22-9-19-44-21-25-49)43(52)35-13-7-10-32(28-35)31-46-39-17-16-36(50-23-5-2-6-24-50)30-38(39)41-29-34(18-20-45-41)42(51)47-40-15-8-12-33-11-3-4-14-37(33)40/h3-4,7,10-11,13-14,16-18,20,28-30,40,44,46H,2,5-6,8-9,12,15,19,21-27,31H2,1H3,(H,47,51) |
| InChIKey | MVVYHCXDFXLKSU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.94 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |