C47H59N7O4 — CID 66587567
tert-butyl 4-[2-[N-methyl-3-[[4-piperidin-1-yl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-2-pyridinyl]phenyl]carbamoyl]anilino]ethyl]-1,4-diazepane-1-carboxylate (PubChem CID 66587567) has the molecular formula C47H59N7O4 and a molecular weight of 786.03 g/mol. Its IUPAC name is tert-butyl 4-[2-[N-methyl-3-[[4-piperidin-1-yl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-2-pyridinyl]phenyl]carbamoyl]anilino]ethyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[N-methyl-3-[[4-piperidin-1-yl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-2-pyridinyl]phenyl]carbamoyl]anilino]ethyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 66587567 |
| Molecular Formula | C47H59N7O4 |
| Molecular Weight | 786.03 g/mol |
| Exact Mass | 785.46 |
| IUPAC Name | tert-butyl 4-[2-[N-methyl-3-[[4-piperidin-1-yl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-2-pyridinyl]phenyl]carbamoyl]anilino]ethyl]-1,4-diazepane-1-carboxylate |
| SMILES | CN(CCN1CCCN(C(=O)OC(C)(C)C)CC1)c1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2-c2cc(C(=O)NC3CCCc4ccccc43)ccn2)c1 |
| InChI | InChI=1S/C47H59N7O4/c1-47(2,3)58-46(57)54-26-12-23-52(29-30-54)28-27-51(4)37-16-10-15-35(31-37)44(55)50-42-20-19-38(53-24-8-5-9-25-53)33-40(42)43-32-36(21-22-48-43)45(56)49-41-18-11-14-34-13-6-7-17-39(34)41/h6-7,10,13,15-17,19-22,31-33,41H,5,8-9,11-12,14,18,23-30H2,1-4H3,(H,49,56)(H,50,55) |
| InChIKey | OBGRHPQQUNISEI-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.03 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |