C9H18N2 — CID 123658459
4-methylocta-2,7-dienylhydrazine (PubChem CID 123658459) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 4-methylocta-2,7-dienylhydrazine.
| Compound Name | 4-methylocta-2,7-dienylhydrazine |
|---|---|
| PubChem CID | 123658459 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 4-methylocta-2,7-dienylhydrazine |
| SMILES | C=CCCC(C)C=CCNN |
| InChI | InChI=1S/C9H18N2/c1-3-4-6-9(2)7-5-8-11-10/h3,5,7,9,11H,1,4,6,8,10H2,2H3 |
| InChIKey | WXQHOMCRFBQMDY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|