C51H97NO10P+ — CID 123659027
[2-[[(2R)-2,3-di(octadec-9-enoyloxy)propoxy]-hydroxyphosphoryl]oxy-3-hexanoyloxypropyl]-trimethylazanium (PubChem CID 123659027) has the molecular formula C51H97NO10P+ and a molecular weight of 915.31 g/mol. Its IUPAC name is [2-[[(2R)-2,3-di(octadec-9-enoyloxy)propoxy]-hydroxyphosphoryl]oxy-3-hexanoyloxypropyl]-trimethylazanium.
| Compound Name | [2-[[(2R)-2,3-di(octadec-9-enoyloxy)propoxy]-hydroxyphosphoryl]oxy-3-hexanoyloxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 123659027 |
| Molecular Formula | C51H97NO10P+ |
| Molecular Weight | 915.31 g/mol |
| Exact Mass | 914.68 |
| IUPAC Name | [2-[[(2R)-2,3-di(octadec-9-enoyloxy)propoxy]-hydroxyphosphoryl]oxy-3-hexanoyloxypropyl]-trimethylazanium |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OC(COC(=O)CCCCC)C[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C51H96NO10P/c1-7-10-13-15-17-19-21-23-25-27-29-31-33-35-38-41-50(54)59-45-48(61-51(55)42-39-36-34-32-30-28-26-24-22-20-18-16-14-11-8-2)46-60-63(56,57)62-47(43-52(4,5)6)44-58-49(53)40-37-12-9-3/h23-26,47-48H,7-22,27-46H2,1-6H3/p+1/t47?,48-/m1/s1 |
| InChIKey | PVOANXIUAABOPO-YZMWRMHMSA-O |
| XLogP | 13.85 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.31 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|