C11H20F3NO2S — CID 123659943
2-[3-(4,4,4-trifluorobutylsulfonyl)propyl]pyrrolidine (PubChem CID 123659943) has the molecular formula C11H20F3NO2S and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-[3-(4,4,4-trifluorobutylsulfonyl)propyl]pyrrolidine.
| Compound Name | 2-[3-(4,4,4-trifluorobutylsulfonyl)propyl]pyrrolidine |
|---|---|
| PubChem CID | 123659943 |
| Molecular Formula | C11H20F3NO2S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-[3-(4,4,4-trifluorobutylsulfonyl)propyl]pyrrolidine |
| SMILES | O=S(=O)(CCCC1CCCN1)CCCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO2S/c12-11(13,14)6-3-9-18(16,17)8-2-5-10-4-1-7-15-10/h10,15H,1-9H2 |
| InChIKey | LLZSCXKLYAAECJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |