About N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine
N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine (PubChem CID 123661547) has the molecular formula C20H33N3
and a molecular weight of 315.50 g/mol. Its IUPAC name is N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine.
Molecular Properties
| Compound Name | N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine |
| PubChem CID | 123661547 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine |
| SMILES | c1ccc(CN(CNC2CCCCC2)CC2CCNCC2)cc1 |
| InChI | InChI=1S/C20H33N3/c1-3-7-18(8-4-1)15-23(16-19-11-13-21-14-12-19)17-22-20-9-5-2-6-10-20/h1,3-4,7-8,19-22H,2,5-6,9-17H2 |
| InChIKey | SLVHKKCSHWLNNU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine?
The IUPAC name of N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine (CID 123661547) is N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine.
What is the SMILES notation for N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine?
The canonical SMILES for N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine is c1ccc(CN(CNC2CCCCC2)CC2CCNCC2)cc1.
What is the InChIKey of N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine?
The InChIKey is SLVHKKCSHWLNNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N3/c1-3-7-18(8-4-1)15-23(16-19-11-13-21-14-12-19)17-22-20-9-5-2-6-10-20/h1,3-4,7-8,19-22H,2,5-6,9-17H2.
What are the key properties of N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine?
N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine has a molecular weight of 315.50 g/mol, XLogP of 3.37, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N-cyclohexyl-N'-(piperidin-4-ylmethyl)methanediamine is sourced from PubChem (CID 123661547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).