C37H51N5O7S — CID 123661768
2-amino-3-[[2-[5-[6-amino-9-(cyclohexa-2,4-dien-1-ylmethoxy)-4-methyl-5,9-dioxononyl]-4-methylcyclohexa-1,3-dien-1-yl]-1,3-thiazole-4-carbonyl]amino]-4-(oxan-4-ylimino)butanoic acid (PubChem CID 123661768) has the molecular formula C37H51N5O7S and a molecular weight of 709.91 g/mol. Its IUPAC name is 2-amino-3-[[2-[5-[6-amino-9-(cyclohexa-2,4-dien-1-ylmethoxy)-4-methyl-5,9-dioxononyl]-4-methylcyclohexa-1,3-dien-1-yl]-1,3-thiazole-4-carbonyl]amino]-4-(oxan-4-ylimino)butanoic acid.
| Compound Name | 2-amino-3-[[2-[5-[6-amino-9-(cyclohexa-2,4-dien-1-ylmethoxy)-4-methyl-5,9-dioxononyl]-4-methylcyclohexa-1,3-dien-1-yl]-1,3-thiazole-4-carbonyl]amino]-4-(oxan-4-ylimino)butanoic acid |
|---|---|
| PubChem CID | 123661768 |
| Molecular Formula | C37H51N5O7S |
| Molecular Weight | 709.91 g/mol |
| Exact Mass | 709.35 |
| IUPAC Name | 2-amino-3-[[2-[5-[6-amino-9-(cyclohexa-2,4-dien-1-ylmethoxy)-4-methyl-5,9-dioxononyl]-4-methylcyclohexa-1,3-dien-1-yl]-1,3-thiazole-4-carbonyl]amino]-4-(oxan-4-ylimino)butanoic acid |
| SMILES | CC1=CC=C(c2nc(C(=O)NC(/C=N/C3CCOCC3)C(N)C(=O)O)cs2)CC1CCCC(C)C(=O)C(N)CCC(=O)OCC1C=CC=CC1 |
| InChI | InChI=1S/C37H51N5O7S/c1-23-11-12-27(36-42-31(22-50-36)35(45)41-30(33(39)37(46)47)20-40-28-15-17-48-18-16-28)19-26(23)10-6-7-24(2)34(44)29(38)13-14-32(43)49-21-25-8-4-3-5-9-25/h3-5,8,11-12,20,22,24-26,28-30,33H,6-7,9-10,13-19,21,38-39H2,1-2H3,(H,41,45)(H,46,47)/b40-20+ |
| InChIKey | XDCCEJWUSFIFSY-KPRPFPDJSA-N |
| XLogP | 4.41 |
| TPSA | 196.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|