C23H34O2 — CID 123663298
11-hydroxy-10,11,13-trimethyl-17-prop-1-en-2-yl-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 123663298) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 11-hydroxy-10,11,13-trimethyl-17-prop-1-en-2-yl-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 11-hydroxy-10,11,13-trimethyl-17-prop-1-en-2-yl-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123663298 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 11-hydroxy-10,11,13-trimethyl-17-prop-1-en-2-yl-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=C(C)C1CCC2C3CCC4=CC(=O)CCC4(C)C3C(C)(O)CC12C |
| InChI | InChI=1S/C23H34O2/c1-14(2)18-8-9-19-17-7-6-15-12-16(24)10-11-21(15,3)20(17)23(5,25)13-22(18,19)4/h12,17-20,25H,1,6-11,13H2,2-5H3 |
| InChIKey | VDXPVMHTRMGCRJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|