C21H32O3 — CID 138501891
(11S,17S)-11,17-dihydroxy-10,11,13,17-tetramethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 138501891) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (11S,17S)-11,17-dihydroxy-10,11,13,17-tetramethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11S,17S)-11,17-dihydroxy-10,11,13,17-tetramethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 138501891 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (11S,17S)-11,17-dihydroxy-10,11,13,17-tetramethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1(O)CC2(C)C(CC[C@]2(C)O)C2CCC3=CC(=O)CCC3(C)C21 |
| InChI | InChI=1S/C21H32O3/c1-18-9-7-14(22)11-13(18)5-6-15-16-8-10-21(4,24)19(16,2)12-20(3,23)17(15)18/h11,15-17,23-24H,5-10,12H2,1-4H3/t15?,16?,17?,18?,19?,20?,21-/m0/s1 |
| InChIKey | IVNPZOKPAMKNEL-QAQLXXJBSA-N |
| XLogP | 3.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |