C20H28N4 — CID 123666018
N-ethenyl-N',6,7-trimethyl-5-[1-(2-methyl-1,4-dihydropyrimidin-5-yl)ethyl]cyclohepta-1,3,5-triene-1-carboximidamide (PubChem CID 123666018) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is N-ethenyl-N',6,7-trimethyl-5-[1-(2-methyl-1,4-dihydropyrimidin-5-yl)ethyl]cyclohepta-1,3,5-triene-1-carboximidamide.
| Compound Name | N-ethenyl-N',6,7-trimethyl-5-[1-(2-methyl-1,4-dihydropyrimidin-5-yl)ethyl]cyclohepta-1,3,5-triene-1-carboximidamide |
|---|---|
| PubChem CID | 123666018 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | N-ethenyl-N',6,7-trimethyl-5-[1-(2-methyl-1,4-dihydropyrimidin-5-yl)ethyl]cyclohepta-1,3,5-triene-1-carboximidamide |
| SMILES | C=CN/C(=N\C)C1=CC=CC(C(C)C2=CNC(C)=NC2)=C(C)C1C |
| InChI | InChI=1S/C20H28N4/c1-7-22-20(21-6)19-10-8-9-18(13(2)14(19)3)15(4)17-11-23-16(5)24-12-17/h7-11,14-15H,1,12H2,2-6H3,(H,21,22)(H,23,24) |
| InChIKey | VJAHXLATUOZCNF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|