C26H40N2 — CID 123705184
N'-(3-methylbut-3-enyl)-N-[(1E)-3-methylocta-1,6-dienyl]-3-pent-2-en-2-ylcyclohexa-1,5-diene-1-carboximidamide (PubChem CID 123705184) has the molecular formula C26H40N2 and a molecular weight of 380.62 g/mol. Its IUPAC name is N'-(3-methylbut-3-enyl)-N-[(1E)-3-methylocta-1,6-dienyl]-3-pent-2-en-2-ylcyclohexa-1,5-diene-1-carboximidamide.
| Compound Name | N'-(3-methylbut-3-enyl)-N-[(1E)-3-methylocta-1,6-dienyl]-3-pent-2-en-2-ylcyclohexa-1,5-diene-1-carboximidamide |
|---|---|
| PubChem CID | 123705184 |
| Molecular Formula | C26H40N2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | N'-(3-methylbut-3-enyl)-N-[(1E)-3-methylocta-1,6-dienyl]-3-pent-2-en-2-ylcyclohexa-1,5-diene-1-carboximidamide |
| SMILES | C=C(C)CC/N=C(\N/C=C/C(C)CCC=CC)C1=CC(C(C)=CCC)CC=C1 |
| InChI | InChI=1S/C26H40N2/c1-7-9-10-13-22(5)17-19-28-26(27-18-16-21(3)4)25-15-11-14-24(20-25)23(6)12-8-2/h7,9,11-12,15,17,19-20,22,24H,3,8,10,13-14,16,18H2,1-2,4-6H3,(H,27,28)/b9-7?,19-17+,23-12? |
| InChIKey | GZRKEIDMNBTEDZ-ZRPRHTPFSA-N |
| XLogP | 7.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|