C24H35N3 — CID 123916132
N-[C-ethenyl-N-(2-methylbut-2-enyl)carbonimidoyl]-N'-methyl-4-(6-methylhepta-4,6-dien-2-yl)cyclohexa-1,4-diene-1-carboximidamide (PubChem CID 123916132) has the molecular formula C24H35N3 and a molecular weight of 365.57 g/mol. Its IUPAC name is N-[C-ethenyl-N-(2-methylbut-2-enyl)carbonimidoyl]-N'-methyl-4-(6-methylhepta-4,6-dien-2-yl)cyclohexa-1,4-diene-1-carboximidamide.
| Compound Name | N-[C-ethenyl-N-(2-methylbut-2-enyl)carbonimidoyl]-N'-methyl-4-(6-methylhepta-4,6-dien-2-yl)cyclohexa-1,4-diene-1-carboximidamide |
|---|---|
| PubChem CID | 123916132 |
| Molecular Formula | C24H35N3 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | N-[C-ethenyl-N-(2-methylbut-2-enyl)carbonimidoyl]-N'-methyl-4-(6-methylhepta-4,6-dien-2-yl)cyclohexa-1,4-diene-1-carboximidamide |
| SMILES | C=C/C(=N\CC(C)=CC)N/C(=N\C)C1=CCC(C(C)CC=CC(=C)C)=CC1 |
| InChI | InChI=1S/C24H35N3/c1-8-19(5)17-26-23(9-2)27-24(25-7)22-15-13-21(14-16-22)20(6)12-10-11-18(3)4/h8-11,13,16,20H,2-3,12,14-15,17H2,1,4-7H3,(H,25,26,27) |
| InChIKey | MVFNKPGSSHVUQD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|