C13H36O8Si4 — CID 123667898
[3-dimethoxysilyl-2,2-bis(dimethoxysilylmethyl)propyl]-dimethoxysilane (PubChem CID 123667898) has the molecular formula C13H36O8Si4 and a molecular weight of 432.77 g/mol. Its IUPAC name is [3-dimethoxysilyl-2,2-bis(dimethoxysilylmethyl)propyl]-dimethoxysilane.
| Compound Name | [3-dimethoxysilyl-2,2-bis(dimethoxysilylmethyl)propyl]-dimethoxysilane |
|---|---|
| PubChem CID | 123667898 |
| Molecular Formula | C13H36O8Si4 |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [3-dimethoxysilyl-2,2-bis(dimethoxysilylmethyl)propyl]-dimethoxysilane |
| SMILES | CO[SiH](CC(C[SiH](OC)OC)(C[SiH](OC)OC)C[SiH](OC)OC)OC |
| InChI | InChI=1S/C13H36O8Si4/c1-14-22(15-2)9-13(10-23(16-3)17-4,11-24(18-5)19-6)12-25(20-7)21-8/h22-25H,9-12H2,1-8H3 |
| InChIKey | LZJQYWMPLVQRDG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|