C7H6N2OS — CID 123668245
5-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole (PubChem CID 123668245) has the molecular formula C7H6N2OS and a molecular weight of 166.20 g/mol. Its IUPAC name is 5-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole.
| Compound Name | 5-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 123668245 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 5-(2-methyl-1,3-thiazol-4-yl)-1,2-oxazole |
| SMILES | Cc1nc(-c2ccno2)cs1 |
| InChI | InChI=1S/C7H6N2OS/c1-5-9-6(4-11-5)7-2-3-8-10-7/h2-4H,1H3 |
| InChIKey | SKUCRUQZPOZENK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |