C8H7NOS — CID 130511762
4-(furan-3-yl)-2-methyl-1,3-thiazole (PubChem CID 130511762) has the molecular formula C8H7NOS and a molecular weight of 165.22 g/mol. Its IUPAC name is 4-(furan-3-yl)-2-methyl-1,3-thiazole.
| Compound Name | 4-(furan-3-yl)-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 130511762 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 4-(furan-3-yl)-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(-c2ccoc2)cs1 |
| InChI | InChI=1S/C8H7NOS/c1-6-9-8(5-11-6)7-2-3-10-4-7/h2-5H,1H3 |
| InChIKey | KROKDZRXBXLBMC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |