C13H9NO2 — CID 134967071
2,6-bis(furan-3-yl)pyridine (PubChem CID 134967071) has the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2,6-bis(furan-3-yl)pyridine.
| Compound Name | 2,6-bis(furan-3-yl)pyridine |
|---|---|
| PubChem CID | 134967071 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2,6-bis(furan-3-yl)pyridine |
| SMILES | c1cc(-c2ccoc2)nc(-c2ccoc2)c1 |
| InChI | InChI=1S/C13H9NO2/c1-2-12(10-4-6-15-8-10)14-13(3-1)11-5-7-16-9-11/h1-9H |
| InChIKey | ULEZXLGJNQSPMM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |