C18H20N4O3 — CID 175906941
2-(furan-3-yl)-6-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]pyridine (PubChem CID 175906941) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-(furan-3-yl)-6-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]pyridine.
| Compound Name | 2-(furan-3-yl)-6-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]pyridine |
|---|---|
| PubChem CID | 175906941 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-(furan-3-yl)-6-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]pyridine |
| SMILES | Cn1nnc(-c2cccc(-c3ccoc3)n2)c1COC1CCCCO1 |
| InChI | InChI=1S/C18H20N4O3/c1-22-16(12-25-17-7-2-3-9-24-17)18(20-21-22)15-6-4-5-14(19-15)13-8-10-23-11-13/h4-6,8,10-11,17H,2-3,7,9,12H2,1H3 |
| InChIKey | RWHIJWCHOGFKJI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |