C16H21N5O3 — CID 168931729
4-cyclopropyl-2-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]pyrimidin-5-ol (PubChem CID 168931729) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-cyclopropyl-2-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]pyrimidin-5-ol.
| Compound Name | 4-cyclopropyl-2-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]pyrimidin-5-ol |
|---|---|
| PubChem CID | 168931729 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-cyclopropyl-2-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]pyrimidin-5-ol |
| SMILES | Cn1nnc(-c2ncc(O)c(C3CC3)n2)c1COC1CCCCO1 |
| InChI | InChI=1S/C16H21N5O3/c1-21-11(9-24-13-4-2-3-7-23-13)15(19-20-21)16-17-8-12(22)14(18-16)10-5-6-10/h8,10,13,22H,2-7,9H2,1H3 |
| InChIKey | YRLIFWNQNCCKGB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |