C18H27BrN4O2Si — CID 175538273
[4-(5-bromo-6-methyl-2-pyridinyl)-5-(oxan-2-yloxymethyl)triazol-1-yl]methyl-trimethylsilane (PubChem CID 175538273) has the molecular formula C18H27BrN4O2Si and a molecular weight of 439.43 g/mol. Its IUPAC name is [4-(5-bromo-6-methyl-2-pyridinyl)-5-(oxan-2-yloxymethyl)triazol-1-yl]methyl-trimethylsilane.
| Compound Name | [4-(5-bromo-6-methyl-2-pyridinyl)-5-(oxan-2-yloxymethyl)triazol-1-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 175538273 |
| Molecular Formula | C18H27BrN4O2Si |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | [4-(5-bromo-6-methyl-2-pyridinyl)-5-(oxan-2-yloxymethyl)triazol-1-yl]methyl-trimethylsilane |
| SMILES | Cc1nc(-c2nnn(C[Si](C)(C)C)c2COC2CCCCO2)ccc1Br |
| InChI | InChI=1S/C18H27BrN4O2Si/c1-13-14(19)8-9-15(20-13)18-16(11-25-17-7-5-6-10-24-17)23(22-21-18)12-26(2,3)4/h8-9,17H,5-7,10-12H2,1-4H3 |
| InChIKey | GDWABNBGJWYENY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|