About 2-chloro-4,6-bis(furan-3-yl)pyrimidine
2-chloro-4,6-bis(furan-3-yl)pyrimidine (PubChem CID 15141666) has the molecular formula C12H7ClN2O2
and a molecular weight of 246.65 g/mol. Its IUPAC name is 2-chloro-4,6-bis(furan-3-yl)pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-4,6-bis(furan-3-yl)pyrimidine |
| PubChem CID | 15141666 |
| Molecular Formula | C12H7ClN2O2 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 2-chloro-4,6-bis(furan-3-yl)pyrimidine |
| SMILES | Clc1nc(-c2ccoc2)cc(-c2ccoc2)n1 |
| InChI | InChI=1S/C12H7ClN2O2/c13-12-14-10(8-1-3-16-6-8)5-11(15-12)9-2-4-17-7-9/h1-7H |
| InChIKey | GXHDUFGZDGHBBQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4,6-bis(furan-3-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,6-bis(furan-3-yl)pyrimidine?
The IUPAC name of 2-chloro-4,6-bis(furan-3-yl)pyrimidine (CID 15141666) is 2-chloro-4,6-bis(furan-3-yl)pyrimidine.
What is the SMILES notation for 2-chloro-4,6-bis(furan-3-yl)pyrimidine?
The canonical SMILES for 2-chloro-4,6-bis(furan-3-yl)pyrimidine is Clc1nc(-c2ccoc2)cc(-c2ccoc2)n1.
What is the InChIKey of 2-chloro-4,6-bis(furan-3-yl)pyrimidine?
The InChIKey is GXHDUFGZDGHBBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClN2O2/c13-12-14-10(8-1-3-16-6-8)5-11(15-12)9-2-4-17-7-9/h1-7H.
What are the key properties of 2-chloro-4,6-bis(furan-3-yl)pyrimidine?
2-chloro-4,6-bis(furan-3-yl)pyrimidine has a molecular weight of 246.65 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,6-bis(furan-3-yl)pyrimidine is sourced from PubChem (CID 15141666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).