C15H18FN — CID 123668721
3-[(7-fluoro-7-methylcycloocta-1,4-dien-1-yl)methyl]pyridine (PubChem CID 123668721) has the molecular formula C15H18FN and a molecular weight of 231.31 g/mol. Its IUPAC name is 3-[(7-fluoro-7-methylcycloocta-1,4-dien-1-yl)methyl]pyridine.
| Compound Name | 3-[(7-fluoro-7-methylcycloocta-1,4-dien-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 123668721 |
| Molecular Formula | C15H18FN |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-[(7-fluoro-7-methylcycloocta-1,4-dien-1-yl)methyl]pyridine |
| SMILES | CC1(F)CC=CCC=C(Cc2cccnc2)C1 |
| InChI | InChI=1S/C15H18FN/c1-15(16)8-4-2-3-6-13(11-15)10-14-7-5-9-17-12-14/h2,4-7,9,12H,3,8,10-11H2,1H3 |
| InChIKey | ZFYYUKZWVSFRPA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|