C18H33N5O5 — CID 123669388
tert-butyl 2-[[2-[(1-hydrazinyl-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 123669388) has the molecular formula C18H33N5O5 and a molecular weight of 399.49 g/mol. Its IUPAC name is tert-butyl 2-[[2-[(1-hydrazinyl-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[2-[(1-hydrazinyl-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123669388 |
| Molecular Formula | C18H33N5O5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | tert-butyl 2-[[2-[(1-hydrazinyl-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)CC(NC(=O)CNC(=O)C1CCCN1C(=O)OC(C)(C)C)C(=O)NN |
| InChI | InChI=1S/C18H33N5O5/c1-11(2)9-12(15(25)22-19)21-14(24)10-20-16(26)13-7-6-8-23(13)17(27)28-18(3,4)5/h11-13H,6-10,19H2,1-5H3,(H,20,26)(H,21,24)(H,22,25) |
| InChIKey | XEERFVHGNNNNTJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|