C12H18N2O8 — CID 123671043
(2S,4R)-1-[[(1S,3R)-1,3-dicarboxybutyl]amino]pyrrolidine-2,4-dicarboxylic acid (PubChem CID 123671043) has the molecular formula C12H18N2O8 and a molecular weight of 318.28 g/mol. Its IUPAC name is (2S,4R)-1-[[(1S,3R)-1,3-dicarboxybutyl]amino]pyrrolidine-2,4-dicarboxylic acid.
| Compound Name | (2S,4R)-1-[[(1S,3R)-1,3-dicarboxybutyl]amino]pyrrolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 123671043 |
| Molecular Formula | C12H18N2O8 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (2S,4R)-1-[[(1S,3R)-1,3-dicarboxybutyl]amino]pyrrolidine-2,4-dicarboxylic acid |
| SMILES | C[C@H](C[C@H](NN1C[C@H](C(=O)O)C[C@H]1C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H18N2O8/c1-5(9(15)16)2-7(11(19)20)13-14-4-6(10(17)18)3-8(14)12(21)22/h5-8,13H,2-4H2,1H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22)/t5-,6-,7+,8+/m1/s1 |
| InChIKey | GIDLYKOLGPBVEM-NGJRWZKOSA-N |
| XLogP | -1.09 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |