C6H10NO4P — CID 134285736
1-phosphanylpyrrolidine-2,4-dicarboxylic acid (PubChem CID 134285736) has the molecular formula C6H10NO4P and a molecular weight of 191.12 g/mol. Its IUPAC name is 1-phosphanylpyrrolidine-2,4-dicarboxylic acid.
| Compound Name | 1-phosphanylpyrrolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 134285736 |
| Molecular Formula | C6H10NO4P |
| Molecular Weight | 191.12 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 1-phosphanylpyrrolidine-2,4-dicarboxylic acid |
| SMILES | O=C(O)C1CC(C(=O)O)N(P)C1 |
| InChI | InChI=1S/C6H10NO4P/c8-5(9)3-1-4(6(10)11)7(12)2-3/h3-4H,1-2,12H2,(H,8,9)(H,10,11) |
| InChIKey | ROTPFVCNEBQIQR-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.12 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|