C6H12NO3P — CID 166910012
(2S,5S)-5-hydroxy-1-phosphanylpiperidine-2-carboxylic acid (PubChem CID 166910012) has the molecular formula C6H12NO3P and a molecular weight of 177.14 g/mol. Its IUPAC name is (2S,5S)-5-hydroxy-1-phosphanylpiperidine-2-carboxylic acid.
| Compound Name | (2S,5S)-5-hydroxy-1-phosphanylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 166910012 |
| Molecular Formula | C6H12NO3P |
| Molecular Weight | 177.14 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2S,5S)-5-hydroxy-1-phosphanylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@H](O)CN1P |
| InChI | InChI=1S/C6H12NO3P/c8-4-1-2-5(6(9)10)7(11)3-4/h4-5,8H,1-3,11H2,(H,9,10)/t4-,5-/m0/s1 |
| InChIKey | ORZHWLKGGMIOIC-WHFBIAKZSA-N |
| XLogP | -0.31 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.14 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|