C20H21N3O3 — CID 123673843
2-[(E)-3-(2,5-dihydroxy-3,4,6-trimethylphenyl)prop-2-enyl]-3H-benzimidazole-5-carboxamide (PubChem CID 123673843) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[(E)-3-(2,5-dihydroxy-3,4,6-trimethylphenyl)prop-2-enyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[(E)-3-(2,5-dihydroxy-3,4,6-trimethylphenyl)prop-2-enyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 123673843 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-[(E)-3-(2,5-dihydroxy-3,4,6-trimethylphenyl)prop-2-enyl]-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1c(C)c(O)c(/C=C/Cc2nc3ccc(C(N)=O)cc3[nH]2)c(C)c1O |
| InChI | InChI=1S/C20H21N3O3/c1-10-11(2)19(25)14(12(3)18(10)24)5-4-6-17-22-15-8-7-13(20(21)26)9-16(15)23-17/h4-5,7-9,24-25H,6H2,1-3H3,(H2,21,26)(H,22,23)/b5-4+ |
| InChIKey | WELKHCMNPXELKL-SNAWJCMRSA-N |
| XLogP | 3.25 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|