C19H25ClN2O — CID 123674894
5-chloro-3-cyclopentyl-2-(4-methylpentan-2-yl)quinazolin-4-one (PubChem CID 123674894) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is 5-chloro-3-cyclopentyl-2-(4-methylpentan-2-yl)quinazolin-4-one.
| Compound Name | 5-chloro-3-cyclopentyl-2-(4-methylpentan-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 123674894 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 5-chloro-3-cyclopentyl-2-(4-methylpentan-2-yl)quinazolin-4-one |
| SMILES | CC(C)CC(C)c1nc2cccc(Cl)c2c(=O)n1C1CCCC1 |
| InChI | InChI=1S/C19H25ClN2O/c1-12(2)11-13(3)18-21-16-10-6-9-15(20)17(16)19(23)22(18)14-7-4-5-8-14/h6,9-10,12-14H,4-5,7-8,11H2,1-3H3 |
| InChIKey | BQVXUEMNXPAYEE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |